C12H15Cl2N3 — CID 115607686
2-(2-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine;hydrochloride (PubChem CID 115607686) has the molecular formula C12H15Cl2N3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 115607686 |
| Molecular Formula | C12H15Cl2N3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine;hydrochloride |
| SMILES | Cl.Clc1ccccc1CCNCc1cnc[nH]1 |
| InChI | InChI=1S/C12H14ClN3.ClH/c13-12-4-2-1-3-10(12)5-6-14-7-11-8-15-9-16-11;/h1-4,8-9,14H,5-7H2,(H,15,16);1H |
| InChIKey | ITQWIMZEPCOSHW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|