C12H14ClN3 — CID 62763703
2-(4-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine (PubChem CID 62763703) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62763703 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
| SMILES | Clc1ccc(CCNCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C12H14ClN3/c13-11-3-1-10(2-4-11)5-6-14-7-12-8-15-9-16-12/h1-4,8-9,14H,5-7H2,(H,15,16) |
| InChIKey | YTORQBFWDPUOBT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|