C13H17N3 — CID 62761782
N-(1H-imidazol-5-ylmethyl)-2-(3-methylphenyl)ethanamine (PubChem CID 62761782) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-2-(3-methylphenyl)ethanamine.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 62761782 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-2-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc(CCNCc2cnc[nH]2)c1 |
| InChI | InChI=1S/C13H17N3/c1-11-3-2-4-12(7-11)5-6-14-8-13-9-15-10-16-13/h2-4,7,9-10,14H,5-6,8H2,1H3,(H,15,16) |
| InChIKey | QPVQJMODRYEVFQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|