C10H12Cl2N4 — CID 115607264
1-(6-chloro-3-pyridinyl)-N-(1H-imidazol-5-ylmethyl)methanamine;hydrochloride (PubChem CID 115607264) has the molecular formula C10H12Cl2N4 and a molecular weight of 259.14 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-N-(1H-imidazol-5-ylmethyl)methanamine;hydrochloride.
| Compound Name | 1-(6-chloro-3-pyridinyl)-N-(1H-imidazol-5-ylmethyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 115607264 |
| Molecular Formula | C10H12Cl2N4 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-N-(1H-imidazol-5-ylmethyl)methanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(CNCc2cnc[nH]2)cn1 |
| InChI | InChI=1S/C10H11ClN4.ClH/c11-10-2-1-8(4-14-10)3-12-5-9-6-13-7-15-9;/h1-2,4,6-7,12H,3,5H2,(H,13,15);1H |
| InChIKey | MMUQQOINUSNDIK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|