C9H12N4 — CID 66407683
N-(1H-imidazol-5-ylmethyl)-1-(1H-pyrrol-3-yl)methanamine (PubChem CID 66407683) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-1-(1H-pyrrol-3-yl)methanamine.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-1-(1H-pyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 66407683 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-1-(1H-pyrrol-3-yl)methanamine |
| SMILES | c1cc(CNCc2cnc[nH]2)c[nH]1 |
| InChI | InChI=1S/C9H12N4/c1-2-10-3-8(1)4-11-5-9-6-12-7-13-9/h1-3,6-7,10-11H,4-5H2,(H,12,13) |
| InChIKey | OBUJHTZTJBFPKO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |