C12H13F2N3 — CID 65230885
N-[(2,5-difluorophenyl)methyl]-2-(1H-imidazol-5-yl)ethanamine (PubChem CID 65230885) has the molecular formula C12H13F2N3 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-2-(1H-imidazol-5-yl)ethanamine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-2-(1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 65230885 |
| Molecular Formula | C12H13F2N3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-2-(1H-imidazol-5-yl)ethanamine |
| SMILES | Fc1ccc(F)c(CNCCc2cnc[nH]2)c1 |
| InChI | InChI=1S/C12H13F2N3/c13-10-1-2-12(14)9(5-10)6-15-4-3-11-7-16-8-17-11/h1-2,5,7-8,15H,3-4,6H2,(H,16,17) |
| InChIKey | PGRSBJQELVJJHD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|