C15H15FN4S — CID 64988515
N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine (PubChem CID 64988515) has the molecular formula C15H15FN4S and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine.
| Compound Name | N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 64988515 |
| Molecular Formula | C15H15FN4S |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine |
| SMILES | Fc1ccc(-c2nc(CNCCc3cnc[nH]3)cs2)cc1 |
| InChI | InChI=1S/C15H15FN4S/c16-12-3-1-11(2-4-12)15-20-14(9-21-15)8-17-6-5-13-7-18-10-19-13/h1-4,7,9-10,17H,5-6,8H2,(H,18,19) |
| InChIKey | CKTRWVPCSVYNSY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|