C14H16N4 — CID 64988316
2-(1H-imidazol-5-yl)-N-(1H-indol-4-ylmethyl)ethanamine (PubChem CID 64988316) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-(1H-imidazol-5-yl)-N-(1H-indol-4-ylmethyl)ethanamine.
| Compound Name | 2-(1H-imidazol-5-yl)-N-(1H-indol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 64988316 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-(1H-imidazol-5-yl)-N-(1H-indol-4-ylmethyl)ethanamine |
| SMILES | c1cc(CNCCc2cnc[nH]2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C14H16N4/c1-2-11(13-5-7-17-14(13)3-1)8-15-6-4-12-9-16-10-18-12/h1-3,5,7,9-10,15,17H,4,6,8H2,(H,16,18) |
| InChIKey | OCQOKXGUOHVIJJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|