C19H23N3S — CID 119110663
N-(1H-indol-4-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propan-1-amine (PubChem CID 119110663) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is N-(1H-indol-4-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propan-1-amine.
| Compound Name | N-(1H-indol-4-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 119110663 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-(1H-indol-4-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propan-1-amine |
| SMILES | c1cc(CNCCCc2nc3c(s2)CCCC3)c2cc[nH]c2c1 |
| InChI | InChI=1S/C19H23N3S/c1-2-8-18-17(6-1)22-19(23-18)9-4-11-20-13-14-5-3-7-16-15(14)10-12-21-16/h3,5,7,10,12,20-21H,1-2,4,6,8-9,11,13H2 |
| InChIKey | BLSFXSZNGGWDQZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|