C22H30IN5S — CID 111984108
3-[3-(1H-indol-3-yl)propyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111984108) has the molecular formula C22H30IN5S and a molecular weight of 523.49 g/mol. Its IUPAC name is 3-[3-(1H-indol-3-yl)propyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[3-(1H-indol-3-yl)propyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111984108 |
| Molecular Formula | C22H30IN5S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 3-[3-(1H-indol-3-yl)propyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1c[nH]c2ccccc12)N(C)Cc1nc2c(s1)CCCC2.I |
| InChI | InChI=1S/C22H29N5S.HI/c1-23-22(27(2)15-21-26-19-11-5-6-12-20(19)28-21)24-13-7-8-16-14-25-18-10-4-3-9-17(16)18;/h3-4,9-10,14,25H,5-8,11-13,15H2,1-2H3,(H,23,24);1H |
| InChIKey | QMRDLTZHRAPMTO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|