C14H21F3N4OS — CID 119153736
1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine (PubChem CID 119153736) has the molecular formula C14H21F3N4OS and a molecular weight of 350.41 g/mol. Its IUPAC name is 1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine.
| Compound Name | 1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine |
|---|---|
| PubChem CID | 119153736 |
| Molecular Formula | C14H21F3N4OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine |
| SMILES | C/N=C(\NCC(O)C(F)(F)F)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H21F3N4OS/c1-18-13(19-7-11(22)14(15,16)17)21(2)8-12-20-9-5-3-4-6-10(9)23-12/h11,22H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | ATXKZWUXBLHWSG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|