C18H30IN5OS — CID 110038808
N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110038808) has the molecular formula C18H30IN5OS and a molecular weight of 491.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110038808 |
| Molecular Formula | C18H30IN5OS |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)N(C)Cc1nc2c(s1)CCCC2.I |
| InChI | InChI=1S/C18H29N5OS.HI/c1-13(2)10-19-18(20-11-17(24)22(3)4)23(5)12-16-21-14-8-6-7-9-15(14)25-16;/h1,6-12H2,2-5H3,(H,19,20);1H |
| InChIKey | UUHAHKJUYVRPDH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|