C17H30IN5OS — CID 110035062
N,N-dimethyl-2-[[propylamino-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110035062) has the molecular formula C17H30IN5OS and a molecular weight of 479.43 g/mol. Its IUPAC name is N,N-dimethyl-2-[[propylamino-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[propylamino-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110035062 |
| Molecular Formula | C17H30IN5OS |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N,N-dimethyl-2-[[propylamino-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)NCCc1nc2c(s1)CCCC2.I |
| InChI | InChI=1S/C17H29N5OS.HI/c1-4-10-18-17(20-12-16(23)22(2)3)19-11-9-15-21-13-7-5-6-8-14(13)24-15;/h4-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | PWCWKOZEADPWFC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|