C21H36IN5OS — CID 110035066
2-[[(cyclohexylmethylamino)-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035066) has the molecular formula C21H36IN5OS and a molecular weight of 533.52 g/mol. Its IUPAC name is 2-[[(cyclohexylmethylamino)-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclohexylmethylamino)-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035066 |
| Molecular Formula | C21H36IN5OS |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 2-[[(cyclohexylmethylamino)-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCc1nc2c(s1)CCCC2)NCC1CCCCC1.I |
| InChI | InChI=1S/C21H35N5OS.HI/c1-26(2)20(27)15-24-21(23-14-16-8-4-3-5-9-16)22-13-12-19-25-17-10-6-7-11-18(17)28-19;/h16H,3-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | ORYCISPINRDHIT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|