C16H26N4S — CID 119161868
1,2-dimethyl-3-[(1-methylcyclopropyl)methyl]-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine (PubChem CID 119161868) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1-methylcyclopropyl)methyl]-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine.
| Compound Name | 1,2-dimethyl-3-[(1-methylcyclopropyl)methyl]-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119161868 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1,2-dimethyl-3-[(1-methylcyclopropyl)methyl]-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1(C)CC1)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C16H26N4S/c1-16(8-9-16)11-18-15(17-2)20(3)10-14-19-12-6-4-5-7-13(12)21-14/h4-11H2,1-3H3,(H,17,18) |
| InChIKey | QIMKBLGWYHBRDN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|