C19H32N4OS — CID 119157264
3-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine (PubChem CID 119157264) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is 3-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine.
| Compound Name | 3-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119157264 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 3-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1(C)CCCCC1O)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H32N4OS/c1-19(11-7-6-10-16(19)24)13-21-18(20-2)23(3)12-17-22-14-8-4-5-9-15(14)25-17/h16,24H,4-13H2,1-3H3,(H,20,21) |
| InChIKey | QUKKVMIBWUJSTC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|