C17H31N5O2S2 — CID 111989619
3-[2-(diethylsulfamoyl)ethyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine (PubChem CID 111989619) has the molecular formula C17H31N5O2S2 and a molecular weight of 401.60 g/mol. Its IUPAC name is 3-[2-(diethylsulfamoyl)ethyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine.
| Compound Name | 3-[2-(diethylsulfamoyl)ethyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111989619 |
| Molecular Formula | C17H31N5O2S2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-[2-(diethylsulfamoyl)ethyl]-1,2-dimethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C17H31N5O2S2/c1-5-22(6-2)26(23,24)12-11-19-17(18-3)21(4)13-16-20-14-9-7-8-10-15(14)25-16/h5-13H2,1-4H3,(H,18,19) |
| InChIKey | FLJWEJHLCCKAFW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|