C20H20ClN5O3S — CID 90919495
3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(4-methylsulfonylphenyl)carbamimidoyl]benzamide (PubChem CID 90919495) has the molecular formula C20H20ClN5O3S and a molecular weight of 445.93 g/mol. Its IUPAC name is 3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(4-methylsulfonylphenyl)carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(4-methylsulfonylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 90919495 |
| Molecular Formula | C20H20ClN5O3S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(4-methylsulfonylphenyl)carbamimidoyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(N/C(=N/CCc2cnc[nH]2)NC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H20ClN5O3S/c1-30(28,29)18-7-5-16(6-8-18)25-20(23-10-9-17-12-22-13-24-17)26-19(27)14-3-2-4-15(21)11-14/h2-8,11-13H,9-10H2,1H3,(H,22,24)(H2,23,25,26,27) |
| InChIKey | DEKSJBFQCFTUGT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|