C28H28FN7S — CID 17088942
1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]thiourea (PubChem CID 17088942) has the molecular formula C28H28FN7S and a molecular weight of 513.65 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17088942 |
| Molecular Formula | C28H28FN7S |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2ccc(F)cc2)NC(=S)Nc2ccc(Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C28H28FN7S/c1-19-18-20(2)32-27(31-19)35-26(30-17-16-21-8-10-22(29)11-9-21)36-28(37)34-25-14-12-24(13-15-25)33-23-6-4-3-5-7-23/h3-15,18,33H,16-17H2,1-2H3,(H3,30,31,32,34,35,36,37) |
| InChIKey | CNWDLCANIIHBLZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|