C21H25FN8S2 — CID 17090260
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea (PubChem CID 17090260) has the molecular formula C21H25FN8S2 and a molecular weight of 472.62 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 17090260 |
| Molecular Formula | C21H25FN8S2 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCSCc2nc[nH]c2C)NC(=S)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H25FN8S2/c1-13-10-14(2)27-20(26-13)29-19(23-8-9-32-11-18-15(3)24-12-25-18)30-21(31)28-17-6-4-16(22)5-7-17/h4-7,10,12H,8-9,11H2,1-3H3,(H,24,25)(H3,23,26,27,28,29,30,31) |
| InChIKey | HZBOFBFIVVPIPN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|