C19H23FN6OS — CID 17089673
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-(4-fluorophenyl)thiourea (PubChem CID 17089673) has the molecular formula C19H23FN6OS and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 17089673 |
| Molecular Formula | C19H23FN6OS |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CC2CCCO2)NC(=S)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H23FN6OS/c1-12-10-13(2)23-18(22-12)25-17(21-11-16-4-3-9-27-16)26-19(28)24-15-7-5-14(20)6-8-15/h5-8,10,16H,3-4,9,11H2,1-2H3,(H3,21,22,23,24,25,26,28) |
| InChIKey | VSYCPUCVYGJHEU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|