C22H23FN6OS — CID 17090135
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea (PubChem CID 17090135) has the molecular formula C22H23FN6OS and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 17090135 |
| Molecular Formula | C22H23FN6OS |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-hydroxyphenyl)ethyl]carbamimidoyl]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2ccc(O)cc2)NC(=S)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H23FN6OS/c1-14-13-15(2)26-21(25-14)28-20(24-12-11-16-3-9-19(30)10-4-16)29-22(31)27-18-7-5-17(23)6-8-18/h3-10,13,30H,11-12H2,1-2H3,(H3,24,25,26,27,28,29,31) |
| InChIKey | WTRVDCWTPOEFKP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|