C28H27FN6OS — CID 17088941
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea (PubChem CID 17088941) has the molecular formula C28H27FN6OS and a molecular weight of 514.63 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17088941 |
| Molecular Formula | C28H27FN6OS |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2ccc(F)cc2)NC(=S)Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C28H27FN6OS/c1-19-18-20(2)32-27(31-19)34-26(30-17-16-21-8-10-22(29)11-9-21)35-28(37)33-23-12-14-25(15-13-23)36-24-6-4-3-5-7-24/h3-15,18H,16-17H2,1-2H3,(H3,30,31,32,33,34,35,37) |
| InChIKey | YKQHCACGRUQUMR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|