C22H27ClN8S2 — CID 17090256
1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea (PubChem CID 17090256) has the molecular formula C22H27ClN8S2 and a molecular weight of 503.10 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17090256 |
| Molecular Formula | C22H27ClN8S2 |
| Molecular Weight | 503.10 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N/C(=N\CCSCc2nc[nH]c2C)Nc2nc(C)cc(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C22H27ClN8S2/c1-13-5-6-18(17(23)9-13)29-22(32)31-20(30-21-27-14(2)10-15(3)28-21)24-7-8-33-11-19-16(4)25-12-26-19/h5-6,9-10,12H,7-8,11H2,1-4H3,(H,25,26)(H3,24,27,28,29,30,31,32) |
| InChIKey | YODVCUKUQPAJDY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|