C21H26N8S — CID 17089216
1-(2,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea (PubChem CID 17089216) has the molecular formula C21H26N8S and a molecular weight of 422.56 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089216 |
| Molecular Formula | C21H26N8S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N/C(=N\CCc2cnc[nH]2)Nc2nc(C)cc(C)n2)c(C)c1 |
| InChI | InChI=1S/C21H26N8S/c1-13-5-6-18(14(2)9-13)27-21(30)29-19(23-8-7-17-11-22-12-24-17)28-20-25-15(3)10-16(4)26-20/h5-6,9-12H,7-8H2,1-4H3,(H,22,24)(H3,23,25,26,27,28,29,30) |
| InChIKey | VFPBICWDOPSFTL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|