C14H19ClN4S — CID 163329394
1-(2,4-dimethylphenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea;hydrochloride (PubChem CID 163329394) has the molecular formula C14H19ClN4S and a molecular weight of 310.85 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea;hydrochloride.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 163329394 |
| Molecular Formula | C14H19ClN4S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea;hydrochloride |
| SMILES | Cc1ccc(NC(=S)NCCc2cnc[nH]2)c(C)c1.Cl |
| InChI | InChI=1S/C14H18N4S.ClH/c1-10-3-4-13(11(2)7-10)18-14(19)16-6-5-12-8-15-9-17-12;/h3-4,7-9H,5-6H2,1-2H3,(H,15,17)(H2,16,18,19);1H |
| InChIKey | TXMXZVPHRBKANQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|