C9H13N3O — CID 54544800
N-[2-(1H-imidazol-5-yl)ethyl]-2-methylprop-2-enamide (PubChem CID 54544800) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 54544800 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C9H13N3O/c1-7(2)9(13)11-4-3-8-5-10-6-12-8/h5-6H,1,3-4H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | ZFTWPVCAHBJBNS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|