C13H17N3O — CID 144920996
(3Z,5Z)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylidenehepta-3,5-dienamide (PubChem CID 144920996) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is (3Z,5Z)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylidenehepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 144920996 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (3Z,5Z)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylidenehepta-3,5-dienamide |
| SMILES | C=C(/C=C\C=C/C)C(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H17N3O/c1-3-4-5-6-11(2)13(17)15-8-7-12-9-14-10-16-12/h3-6,9-10H,2,7-8H2,1H3,(H,14,16)(H,15,17)/b4-3-,6-5- |
| InChIKey | HERAYCPZOBWSLP-OUPQRBNQSA-N |
| XLogP | 1.76 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|