C7H12N4O — CID 70309768
N'-[2-(1H-imidazol-5-yl)ethyl]acetohydrazide (PubChem CID 70309768) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is N'-[2-(1H-imidazol-5-yl)ethyl]acetohydrazide.
| Compound Name | N'-[2-(1H-imidazol-5-yl)ethyl]acetohydrazide |
|---|---|
| PubChem CID | 70309768 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N'-[2-(1H-imidazol-5-yl)ethyl]acetohydrazide |
| SMILES | CC(=O)NNCCc1cnc[nH]1 |
| InChI | InChI=1S/C7H12N4O/c1-6(12)11-10-3-2-7-4-8-5-9-7/h4-5,10H,2-3H2,1H3,(H,8,9)(H,11,12) |
| InChIKey | DITLWGFKSAMNNQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|