C20H23N3S — CID 43952970
1-(2,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea (PubChem CID 43952970) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 43952970 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCCc2c(C)[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C20H23N3S/c1-13-8-9-18(14(2)12-13)23-20(24)21-11-10-16-15(3)22-19-7-5-4-6-17(16)19/h4-9,12,22H,10-11H2,1-3H3,(H2,21,23,24) |
| InChIKey | MVENGXLHPLIACA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|