C21H25N3OS — CID 12005981
1-(3,5-dimethylphenyl)-3-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]thiourea (PubChem CID 12005981) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 12005981 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]thiourea |
| SMILES | COc1ccc2[nH]c(C)c(CCNC(=S)Nc3cc(C)cc(C)c3)c2c1 |
| InChI | InChI=1S/C21H25N3OS/c1-13-9-14(2)11-16(10-13)24-21(26)22-8-7-18-15(3)23-20-6-5-17(25-4)12-19(18)20/h5-6,9-12,23H,7-8H2,1-4H3,(H2,22,24,26) |
| InChIKey | RHVFWXUHTIXPGF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|