C19H17F3N2O2 — CID 113086126
2,3,4-trifluoro-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzamide (PubChem CID 113086126) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113086126 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]benzamide |
| SMILES | COc1ccc2[nH]c(C)c(CCNC(=O)c3ccc(F)c(F)c3F)c2c1 |
| InChI | InChI=1S/C19H17F3N2O2/c1-10-12(14-9-11(26-2)3-6-16(14)24-10)7-8-23-19(25)13-4-5-15(20)18(22)17(13)21/h3-6,9,24H,7-8H2,1-2H3,(H,23,25) |
| InChIKey | WHPKDCGNEQXEBX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|