C19H15F3N2O3 — CID 110325968
2,3,4-trifluoro-N-[2-(7-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide (PubChem CID 110325968) has the molecular formula C19H15F3N2O3 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(7-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(7-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110325968 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(7-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide |
| SMILES | COc1ccc2cc(CCNC(=O)c3ccc(F)c(F)c3F)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H15F3N2O3/c1-27-12-3-2-10-8-11(18(25)24-15(10)9-12)6-7-23-19(26)13-4-5-14(20)17(22)16(13)21/h2-5,8-9H,6-7H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | PCBSYSISZZHGLH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|