C19H16Cl2N2O2 — CID 4147135
2,4-dichloro-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]benzamide (PubChem CID 4147135) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 4147135 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2,4-dichloro-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]benzamide |
| SMILES | Cc1ccc2cc(CCNC(=O)c3ccc(Cl)cc3Cl)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-11-2-3-12-9-13(18(24)23-17(12)8-11)6-7-22-19(25)15-5-4-14(20)10-16(15)21/h2-5,8-10H,6-7H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | ZZXXLRWQMYOMCY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |