C20H22N4O2 — CID 110616799
2-(dimethylamino)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]pyridine-3-carboxamide (PubChem CID 110616799) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-(dimethylamino)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110616799 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(dimethylamino)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc2cc(CCNC(=O)c3cccnc3N(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H22N4O2/c1-13-6-7-14-12-15(19(25)23-17(14)11-13)8-10-22-20(26)16-5-4-9-21-18(16)24(2)3/h4-7,9,11-12H,8,10H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | YUDSIIRBRWJIGY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |