C15H16Cl2N2O — CID 110415725
2,4-dichloro-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzamide (PubChem CID 110415725) has the molecular formula C15H16Cl2N2O and a molecular weight of 311.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110415725 |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2,4-dichloro-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzamide |
| SMILES | Cc1cc(CCNC(=O)c2ccc(Cl)cc2Cl)c(C)[nH]1 |
| InChI | InChI=1S/C15H16Cl2N2O/c1-9-7-11(10(2)19-9)5-6-18-15(20)13-4-3-12(16)8-14(13)17/h3-4,7-8,19H,5-6H2,1-2H3,(H,18,20) |
| InChIKey | DHAMIPVOMWBEMG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |