C17H16Cl2N2O5 — CID 46483761
2,4-dichloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]benzamide (PubChem CID 46483761) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46483761 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2,4-dichloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]benzamide |
| SMILES | COc1cc(CCNC(=O)c2ccc(Cl)cc2Cl)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-25-15-7-10(14(21(23)24)9-16(15)26-2)5-6-20-17(22)12-4-3-11(18)8-13(12)19/h3-4,7-9H,5-6H2,1-2H3,(H,20,22) |
| InChIKey | DHISNSYNBAQFOS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|