C18H19FN2O5S — CID 17440543
N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 17440543) has the molecular formula C18H19FN2O5S and a molecular weight of 394.42 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 17440543 |
| Molecular Formula | C18H19FN2O5S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | COc1cc(CCNC(=O)CSc2ccccc2F)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H19FN2O5S/c1-25-15-9-12(14(21(23)24)10-16(15)26-2)7-8-20-18(22)11-27-17-6-4-3-5-13(17)19/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,22) |
| InChIKey | MCLVHCGDPSNBJL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|