C20H20BrN3O5 — CID 46490443
3-bromo-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-methylindole-2-carboxamide (PubChem CID 46490443) has the molecular formula C20H20BrN3O5 and a molecular weight of 462.30 g/mol. Its IUPAC name is 3-bromo-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-methylindole-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 46490443 |
| Molecular Formula | C20H20BrN3O5 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 3-bromo-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-1-methylindole-2-carboxamide |
| SMILES | COc1cc(CCNC(=O)c2c(Br)c3ccccc3n2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H20BrN3O5/c1-23-14-7-5-4-6-13(14)18(21)19(23)20(25)22-9-8-12-10-16(28-2)17(29-3)11-15(12)24(26)27/h4-7,10-11H,8-9H2,1-3H3,(H,22,25) |
| InChIKey | KKZYXNDVCASKRV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|