C24H24N2O5 — CID 46637806
N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2,2-diphenylacetamide (PubChem CID 46637806) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 46637806 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2,2-diphenylacetamide |
| SMILES | COc1cc(CCNC(=O)C(c2ccccc2)c2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H24N2O5/c1-30-21-15-19(20(26(28)29)16-22(21)31-2)13-14-25-24(27)23(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,15-16,23H,13-14H2,1-2H3,(H,25,27) |
| InChIKey | QCOQKRGRRRKFMH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|