C21H27N3O4 — CID 52539640
(2R)-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine (PubChem CID 52539640) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2R)-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine.
| Compound Name | (2R)-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 52539640 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2R)-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine |
| SMILES | COc1cc(CNC[C@@H](c2ccccc2)N2CCCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H27N3O4/c1-27-20-12-17(18(24(25)26)13-21(20)28-2)14-22-15-19(23-10-6-7-11-23)16-8-4-3-5-9-16/h3-5,8-9,12-13,19,22H,6-7,10-11,14-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | IAPONCHHDBZGNP-IBGZPJMESA-N |
| XLogP | 3.54 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|