C19H24ClN3O5 — CID 120608355
3-(2-aminophenyl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]propanamide;hydrochloride (PubChem CID 120608355) has the molecular formula C19H24ClN3O5 and a molecular weight of 409.87 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120608355 |
| Molecular Formula | C19H24ClN3O5 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-(2-aminophenyl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]propanamide;hydrochloride |
| SMILES | COc1cc(CCNC(=O)CCc2ccccc2N)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C19H23N3O5.ClH/c1-26-17-11-14(16(22(24)25)12-18(17)27-2)9-10-21-19(23)8-7-13-5-3-4-6-15(13)20;/h3-6,11-12H,7-10,20H2,1-2H3,(H,21,23);1H |
| InChIKey | QZXPEGXBYYNNQV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|