C26H27N3O6 — CID 46656128
N-[1-[2-(4,5-dimethoxy-2-nitrophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 46656128) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-[1-[2-(4,5-dimethoxy-2-nitrophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | N-[1-[2-(4,5-dimethoxy-2-nitrophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 46656128 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[1-[2-(4,5-dimethoxy-2-nitrophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | COc1cc(CCNC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C26H27N3O6/c1-34-23-16-20(22(29(32)33)17-24(23)35-2)13-14-27-26(31)21(15-18-9-5-3-6-10-18)28-25(30)19-11-7-4-8-12-19/h3-12,16-17,21H,13-15H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | YCUINRIYXBVCPA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|