C20H21BrN2O3 — CID 46435379
3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylindole-2-carboxamide (PubChem CID 46435379) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is 3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylindole-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 46435379 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylindole-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2c(Br)c3ccccc3n2C)cc1OC |
| InChI | InChI=1S/C20H21BrN2O3/c1-23-15-7-5-4-6-14(15)18(21)19(23)20(24)22-11-10-13-8-9-16(25-2)17(12-13)26-3/h4-9,12H,10-11H2,1-3H3,(H,22,24) |
| InChIKey | LCRWGBOBIRAPRR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |