C20H21ClN2O7 — CID 26977321
6-chloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide (PubChem CID 26977321) has the molecular formula C20H21ClN2O7 and a molecular weight of 436.85 g/mol. Its IUPAC name is 6-chloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide.
| Compound Name | 6-chloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide |
|---|---|
| PubChem CID | 26977321 |
| Molecular Formula | C20H21ClN2O7 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 6-chloro-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide |
| SMILES | COc1cc(CCNC(=O)c2cc(Cl)c3c(c2)OCCCO3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H21ClN2O7/c1-27-16-9-12(15(23(25)26)11-17(16)28-2)4-5-22-20(24)13-8-14(21)19-18(10-13)29-6-3-7-30-19/h8-11H,3-7H2,1-2H3,(H,22,24) |
| InChIKey | FMHZLHKRFSVALP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|