C19H20ClNO5 — CID 55416510
6-chloro-N-[2-(4-methoxyphenoxy)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide (PubChem CID 55416510) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is 6-chloro-N-[2-(4-methoxyphenoxy)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide.
| Compound Name | 6-chloro-N-[2-(4-methoxyphenoxy)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide |
|---|---|
| PubChem CID | 55416510 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 6-chloro-N-[2-(4-methoxyphenoxy)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cc(Cl)c3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C19H20ClNO5/c1-23-14-3-5-15(6-4-14)24-10-7-21-19(22)13-11-16(20)18-17(12-13)25-8-2-9-26-18/h3-6,11-12H,2,7-10H2,1H3,(H,21,22) |
| InChIKey | ZJERWIGJBUOWLY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|