C20H21ClN2O5 — CID 55880096
N-[2-[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]amino]ethyl]-4-methoxybenzamide (PubChem CID 55880096) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is N-[2-[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]amino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]amino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55880096 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[2-[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]amino]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Cc2cc(Cl)c3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H21ClN2O5/c1-26-15-4-2-14(3-5-15)20(25)23-7-6-22-18(24)12-13-10-16(21)19-17(11-13)27-8-9-28-19/h2-5,10-11H,6-9,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | BUQPYMJFCZFAPT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|