C16H14Cl2N2O4 — CID 9269435
N-[2-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-nitrobenzamide (PubChem CID 9269435) has the molecular formula C16H14Cl2N2O4 and a molecular weight of 369.20 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-nitrobenzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 9269435 |
| Molecular Formula | C16H14Cl2N2O4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-nitrobenzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O4/c1-24-15-5-4-12(20(22)23)9-13(15)16(21)19-7-6-10-2-3-11(17)8-14(10)18/h2-5,8-9H,6-7H2,1H3,(H,19,21) |
| InChIKey | CCBCGPJJIGZRAO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|