C17H15ClF2N2O5 — CID 8528872
5-chloro-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-nitrobenzamide (PubChem CID 8528872) has the molecular formula C17H15ClF2N2O5 and a molecular weight of 400.77 g/mol. Its IUPAC name is 5-chloro-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 8528872 |
| Molecular Formula | C17H15ClF2N2O5 |
| Molecular Weight | 400.77 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 5-chloro-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-nitrobenzamide |
| SMILES | COc1cc(CCNC(=O)c2cc(Cl)ccc2[N+](=O)[O-])ccc1OC(F)F |
| InChI | InChI=1S/C17H15ClF2N2O5/c1-26-15-8-10(2-5-14(15)27-17(19)20)6-7-21-16(23)12-9-11(18)3-4-13(12)22(24)25/h2-5,8-9,17H,6-7H2,1H3,(H,21,23) |
| InChIKey | SAGQKHJYGXBHLO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|