C15H12Cl3NO2 — CID 28537404
4-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-2-hydroxybenzamide (PubChem CID 28537404) has the molecular formula C15H12Cl3NO2 and a molecular weight of 344.63 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 28537404 |
| Molecular Formula | C15H12Cl3NO2 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 4-chloro-N-[2-(2,4-dichlorophenyl)ethyl]-2-hydroxybenzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C15H12Cl3NO2/c16-10-2-1-9(13(18)7-10)5-6-19-15(21)12-4-3-11(17)8-14(12)20/h1-4,7-8,20H,5-6H2,(H,19,21) |
| InChIKey | ZDMHGRVUIAIAAH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |